Difference between revisions of "CPD-18761"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tau-proteins Tau-proteins] == * common name: ** a tau protein * Synonym(s): == Reaction(s) kno...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == * smiles: ** COC1(=CC(=CCCO)C=CC(=O)1) * inchi key: ** InChIKey=ORAJWSY...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18761 CPD-18761] == |
| + | * smiles: | ||
| + | ** COC1(=CC(=CCCO)C=CC(=O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** coniferyl alcohol radical |
| + | * molecular weight: | ||
| + | ** 179.195 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17352]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | {{#set: smiles=COC1(=CC(=CCCO)C=CC(=O)1)}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N}} |
| + | {{#set: common name=coniferyl alcohol radical}} | ||
| + | {{#set: molecular weight=179.195 }} | ||
| + | {{#set: produced by=RXN-17352}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-18761
- smiles:
- COC1(=CC(=CCCO)C=CC(=O)1)
- inchi key:
- InChIKey=ORAJWSYKRGVTDP-UHFFFAOYSA-N
- common name:
- coniferyl alcohol radical
- molecular weight:
- 179.195
- Synonym(s):
