Difference between revisions of "NITRATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRATE NITRATE] == * smiles: ** N(=O)(=O)[O-] * inchi key: ** InChIKey=NHNBFGGVMKEFGY-UHFFFAOY...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRATE NITRATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** N(=O)(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=NHNBFGGVMKEFGY-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** nitrate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 62.005 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** NO3 |
| − | ** | + | ** NO3- |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NITRATE-REDUCTASE-NADPH-RXN]] |
| + | * [[TransportSeed_NITRATE]] | ||
| + | * [[NITRATE-REDUCTASE-NADH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[TransportSeed_NITRATE]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[ExchangeSeed_NITRATE]] |
| + | * [[NITRATE-REDUCTASE-NADPORNOPH-RXN]] | ||
| + | * [[TCV3]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 14797-55-8 |
| − | * | + | * Wikipedia : Nitrate |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=943 943] |
| − | * HMDB : | + | * HMDB : HMDB02878 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00244 C00244] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.918.html 918] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17632 17632] |
| − | * BIGG : | + | * BIGG : 50426 |
| − | {{#set: smiles= | + | {{#set: smiles=N(=O)(=O)[O-]}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=NHNBFGGVMKEFGY-UHFFFAOYSA-N}} |
| − | {{#set: common name= | + | {{#set: common name=nitrate}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=62.005 }} |
| − | {{#set: common name= | + | {{#set: common name=NO3|NO3-}} |
| − | {{#set: | + | {{#set: consumed by=NITRATE-REDUCTASE-NADPH-RXN|TransportSeed_NITRATE|NITRATE-REDUCTASE-NADH-RXN}} |
| − | {{#set: reversible reaction associated= | + | {{#set: produced by=TransportSeed_NITRATE}} |
| + | {{#set: reversible reaction associated=ExchangeSeed_NITRATE|NITRATE-REDUCTASE-NADPORNOPH-RXN|TCV3}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite NITRATE
- smiles:
- N(=O)(=O)[O-]
- inchi key:
- InChIKey=NHNBFGGVMKEFGY-UHFFFAOYSA-N
- common name:
- nitrate
- molecular weight:
- 62.005
- Synonym(s):
- NO3
- NO3-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 14797-55-8
- Wikipedia : Nitrate
- PUBCHEM:
- HMDB : HMDB02878
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 50426
"N(=O)(=O)[O-" cannot be used as a page name in this wiki.
