Difference between revisions of "CPD-9646"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NITRATE NITRATE] == * smiles: ** N(=O)(=O)[O-] * inchi key: ** InChIKey=NHNBFGGVMKEFGY-UHFFFAOY...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9646 CPD-9646] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L |
* common name: | * common name: | ||
| − | ** | + | ** di-trans,octa-cis-undecaprenyl phosphate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 845.279 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ditrans,polycis-undecaprenyl phosphate |
| − | ** | + | ** ditrans,octacis-undecaprenyl phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-11347]] |
| − | * [[ | + | * [[PHOSNACMURPENTATRANS-RXN]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-8975]] |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C17556 C17556] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60392 60392] |
| − | * | + | * PUBCHEM: |
| − | {{#set: smiles= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245635 25245635] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L}} |
| − | {{#set: molecular weight= | + | {{#set: common name=di-trans,octa-cis-undecaprenyl phosphate}} |
| − | {{#set: common name= | + | {{#set: molecular weight=845.279 }} |
| − | {{#set: consumed by= | + | {{#set: common name=ditrans,polycis-undecaprenyl phosphate|ditrans,octacis-undecaprenyl phosphate}} |
| − | {{#set: | + | {{#set: consumed by=RXN-11347|PHOSNACMURPENTATRANS-RXN}} |
| − | + | {{#set: reversible reaction associated=RXN-8975}} | |
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-9646
- smiles:
- CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C
- inchi key:
- InChIKey=UFPHFKCTOZIAFY-NTDVEAECSA-L
- common name:
- di-trans,octa-cis-undecaprenyl phosphate
- molecular weight:
- 845.279
- Synonym(s):
- ditrans,polycis-undecaprenyl phosphate
- ditrans,octacis-undecaprenyl phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])[O-])C)C)C" cannot be used as a page name in this wiki.
