Difference between revisions of "CPD-11740"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-14_001680 == * left end position: ** 1587097 * transcription direction: ** POSITIVE * right end position: ** 1593550 * centisome position: ** 24.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K |
| − | * | + | * common name: |
| − | ** | + | ** carboxyphosphinopyruvate |
| − | * | + | * molecular weight: |
| − | ** | + | ** 193.029 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-10828]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-10827]] | |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707] |
| − | {{#set: | + | {{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}} |
| − | {{#set: | + | {{#set: common name=carboxyphosphinopyruvate}} |
| − | {{#set: | + | {{#set: molecular weight=193.029 }} |
| − | {{#set: | + | {{#set: consumed by=RXN-10828}} |
| + | {{#set: produced by=RXN-10827}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite CPD-11740
- smiles:
- C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
- inchi key:
- InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
- common name:
- carboxyphosphinopyruvate
- molecular weight:
- 193.029
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.
