Difference between revisions of "DODECANOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DODECANOATE DODECANOATE] == * smiles: ** CCCCCCCCCCCC([O-])=O * inchi key: ** InChIKey=POULHZVO...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DODECANOATE DODECANOATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCCCCCCCC([O-])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=POULHZVOKOAJMA-UHFFFAOYSA-M |
* common name: | * common name: | ||
| − | ** | + | ** laurate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 199.312 |
* Synonym(s): | * Synonym(s): | ||
| + | ** n-dodecanoic acid | ||
| + | ** dodecanoic acid | ||
| + | ** lauric acid | ||
| + | ** tin II 2-ethylhexanoate | ||
| + | ** dodecanoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-16393]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5026 5026] | ||
| + | * CAS : 143-07-7 | ||
| + | * BIGG : 40351 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4149208 4149208] |
| − | {{#set: smiles= | + | * HMDB : HMDB00638 |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02679 C02679] |
| − | {{#set: molecular weight= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.3361474.html 3361474] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18262 18262] | ||
| + | * METABOLIGHTS : MTBLC18262 | ||
| + | {{#set: smiles=CCCCCCCCCCCC([O-])=O}} | ||
| + | {{#set: inchi key=InChIKey=POULHZVOKOAJMA-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=laurate}} | ||
| + | {{#set: molecular weight=199.312 }} | ||
| + | {{#set: common name=n-dodecanoic acid|dodecanoic acid|lauric acid|tin II 2-ethylhexanoate|dodecanoate}} | ||
| + | {{#set: consumed by=RXN-16393}} | ||
Latest revision as of 19:46, 21 March 2018
Contents
Metabolite DODECANOATE
- smiles:
- CCCCCCCCCCCC([O-])=O
- inchi key:
- InChIKey=POULHZVOKOAJMA-UHFFFAOYSA-M
- common name:
- laurate
- molecular weight:
- 199.312
- Synonym(s):
- n-dodecanoic acid
- dodecanoic acid
- lauric acid
- tin II 2-ethylhexanoate
- dodecanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- NCI:
- CAS : 143-07-7
- BIGG : 40351
- PUBCHEM:
- HMDB : HMDB00638
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18262
"CCCCCCCCCCCC([O-])=O" cannot be used as a page name in this wiki.
