Difference between revisions of "Ec-01 006960"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] == * smiles: ** C(=O)([O-])C1(C=CC(=CC=1)N) * inchi key: **...")
 
(Created page with "Category:Gene == Gene Ec-01_006960 == * left end position: ** 5959922 * transcription direction: ** POSITIVE * right end position: ** 5972407 * centisome position: ** 57.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-AMINO-BENZOATE P-AMINO-BENZOATE] ==
+
== Gene Ec-01_006960 ==
−
* smiles:
+
* left end position:
−
** C(=O)([O-])C1(C=CC(=CC=1)N)
+
** 5959922
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-aminobenzoate
+
** 5972407
−
* molecular weight:
+
* centisome position:
−
** 136.13    
+
** 57.757706    
 
* Synonym(s):
 
* Synonym(s):
−
** para-aminobenzoic acid
+
** Esi_0002_0235
−
** p-aminobenzoic acid
+
** Esi0002_0235
−
** para-aminobenzoate
+
** CTSH
−
** p-aminobenzoate
+
−
** 4-aminobenzoic acid
+
−
** pABA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[H2PTEROATESYNTH-RXN]]
+
* Reaction: [[3.4.22.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[ADCLY-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 150-13-0
+
{{#set: left end position=5959922}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4876 4876]
+
{{#set: right end position=5972407}}
−
* HMDB : HMDB01392
+
{{#set: centisome position=57.757706   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0002_0235|Esi0002_0235|CTSH}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00568 C00568]
+
{{#set: reaction associated=3.4.22.16-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4710.html 4710]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17836 17836]
+
−
* BIGG : 35376
+
−
{{#set: smiles=C(=O)([O-])C1(C=CC(=CC=1)N)}}
+
−
{{#set: inchi key=InChIKey=ALYNCZNDIQEVRV-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-aminobenzoate}}
+
−
{{#set: molecular weight=136.13   }}
+
−
{{#set: common name=para-aminobenzoic acid|p-aminobenzoic acid|para-aminobenzoate|p-aminobenzoate|4-aminobenzoic acid|pABA}}
+
−
{{#set: consumed by=H2PTEROATESYNTH-RXN}}
+
−
{{#set: consumed or produced by=ADCLY-RXN}}
+

Latest revision as of 19:47, 21 March 2018

Gene Ec-01_006960

  • left end position:
    • 5959922
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5972407
  • centisome position:
    • 57.757706
  • Synonym(s):
    • Esi_0002_0235
    • Esi0002_0235
    • CTSH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_006960&oldid=29277"