Difference between revisions of "DIVINYL-PROTOCHLOROPHYLLIDE-A"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-01_006960 == * left end position: ** 5959922 * transcription direction: ** POSITIVE * right end position: ** 5972407 * centisome position: ** 57.7...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-01_006960 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
−
* left end position:
+
* smiles:
−
** 5959922
+
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 3,8-divinyl protochlorophyllide a
−
* right end position:
+
* molecular weight:
−
** 5972407
+
** 608.935    
−
* centisome position:
+
−
** 57.757706    
+
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0002_0235
+
** divinylprotochlorophyllide
−
** Esi0002_0235
+
−
** CTSH
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[3.4.22.16-RXN]]
+
* [[RXN-5285]]
−
** Source: [[annotation-esiliculosus_genome]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5959922}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
−
{{#set: right end position=5972407}}
+
* CHEBI:
−
{{#set: centisome position=57.757706   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
−
{{#set: common name=Esi_0002_0235|Esi0002_0235|CTSH}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=3.4.22.16-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
 +
{{#set: common name=3,8-divinyl protochlorophyllide a}}
 +
{{#set: molecular weight=608.935   }}
 +
{{#set: common name=divinylprotochlorophyllide}}
 +
{{#set: consumed by=RXN-5285}}

Latest revision as of 19:47, 21 March 2018

Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • 3,8-divinyl protochlorophyllide a
  • molecular weight:
    • 608.935
  • Synonym(s):
    • divinylprotochlorophyllide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DIVINYL-PROTOCHLOROPHYLLIDE-A&oldid=29324"