Difference between revisions of "L-BETA-ASPARTYL-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-08_000860 == * left end position: ** 851507 * transcription direction: ** NEGATIVE * right end position: ** 864783 * centisome position: ** 12.714...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == * smiles: ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-BETA-ASPARTYL-P L-BETA-ASPARTYL-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L |
− | * | + | * common name: |
− | ** | + | ** L-aspartyl-4-phosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 211.068 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-phospho-L-aspartate |
− | ** | + | ** L-4-aspartyl phosphate |
+ | ** L-β-aspartyl-P | ||
+ | ** L-β-aspartyl-phosphate | ||
+ | ** L-aspartyl-4-P | ||
+ | ** L-aspartyl-β-phosphate | ||
+ | ** 4-phosphonato-L-aspartate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
− | + | * [[ASPARTATEKIN-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 22138-53-0 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11948925 11948925] |
− | {{#set: | + | * HMDB : HMDB12250 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03082 C03082] | |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.10123241.html 10123241] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57535 57535] | ||
+ | * BIGG : 41164 | ||
+ | {{#set: smiles=C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L}} | ||
+ | {{#set: common name=L-aspartyl-4-phosphate}} | ||
+ | {{#set: molecular weight=211.068 }} | ||
+ | {{#set: common name=4-phospho-L-aspartate|L-4-aspartyl phosphate|L-β-aspartyl-P|L-β-aspartyl-phosphate|L-aspartyl-4-P|L-aspartyl-β-phosphate|4-phosphonato-L-aspartate}} | ||
+ | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN|ASPARTATEKIN-RXN}} |
Latest revision as of 19:47, 21 March 2018
Contents
Metabolite L-BETA-ASPARTYL-P
- smiles:
- C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-]
- inchi key:
- InChIKey=IXZNKTPIYKDIGG-REOHCLBHSA-L
- common name:
- L-aspartyl-4-phosphate
- molecular weight:
- 211.068
- Synonym(s):
- 4-phospho-L-aspartate
- L-4-aspartyl phosphate
- L-β-aspartyl-P
- L-β-aspartyl-phosphate
- L-aspartyl-4-P
- L-aspartyl-β-phosphate
- 4-phosphonato-L-aspartate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 22138-53-0
- PUBCHEM:
- HMDB : HMDB12250
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 41164
"C(C([N+])C(=O)[O-])C(=O)OP([O-])(=O)[O-" cannot be used as a page name in this wiki.