Difference between revisions of "RXN0-6491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydroorotate dehydrogenas...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEOYL-COA OLEOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J
+
 
* common name:
 
* common name:
** oleoyl-CoA
+
** dihydroorotate dehydrogenase
* molecular weight:
+
* ec number:
** 1027.953   
+
** [http://enzyme.expasy.org/EC/1.3.5.2 EC-1.3.5.2]
 
* Synonym(s):
 
* Synonym(s):
** oloeyl-CoA (cis)
 
** cis-octadec-9-enoyl-CoA
 
** (9Z)-octadec-9-enoyl-CoA
 
** 18:1 cis-9
 
** 18:1(n-9)
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-15044]]
+
* With identifiers:
* [[RXN-15045]]
+
** 1 [[DI-H-OROTATE]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[OROTATE]][c]
* [[RXN-15043]]
+
* With common name(s):
* [[RXN-13322]]
+
** 1 (S)-dihydroorotate[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 orotate[c]
* [[RXN-9601]]
+
 
* [[RXN-17775]]
+
== Genes associated with this reaction  ==
== Reaction(s) known to produce the compound ==
+
Genes have been associated with this reaction based on different elements listed below.
* [[RXN-9644]]
+
* Gene: [[Ec-27_005670]]
* [[RXN0-7239]]
+
** Source: [[annotation-esiliculosus_genome]]
* [[1.14.19.1-RXN]]
+
*** Assignment: GO-TERM
== Reaction(s) of unknown directionality ==
+
== Pathways  ==
* [[RXN-9670]]
+
* [[PWY-5686]], UMP biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686]
* [[RXN-15036]]
+
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
* RHEA:
** [http://www.genome.jp/dbget-bin/www_bget?C00510 C00510]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28690 28690]
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57387 57387]
+
{{#set: common name=dihydroorotate dehydrogenase}}
* METABOLIGHTS : MTBLC57387
+
{{#set: ec number=EC-1.3.5.2}}
* PUBCHEM:
+
{{#set: gene associated=Ec-27_005670}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245426 25245426]
+
{{#set: in pathway=PWY-5686}}
* HMDB : HMDB01322
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: inchi key=InChIKey=XDUHQPOXLUAVEE-BPMMELMSSA-J}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=oleoyl-CoA}}
+
{{#set: molecular weight=1027.953    }}
+
{{#set: common name=oloeyl-CoA (cis)|cis-octadec-9-enoyl-CoA|(9Z)-octadec-9-enoyl-CoA|18:1 cis-9|18:1(n-9)}}
+
{{#set: consumed by=RXN-15044|RXN-15045|RXN-15043|RXN-13322|RXN-9601|RXN-17775}}
+
{{#set: produced by=RXN-9644|RXN0-7239|1.14.19.1-RXN}}
+
{{#set: reversible reaction associated=RXN-9670|RXN-15036}}
+

Latest revision as of 19:47, 21 March 2018

Reaction RXN0-6491

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dihydroorotate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5686, UMP biosynthesis: PWY-5686
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links