Difference between revisions of "RXN0-6491"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] == * direction: ** LEFT-TO-RIGHT * common name: ** dihydroorotate dehydrogenas...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6491 RXN0-6491] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 3,8-divinyl protochlorophyllide a
+
** dihydroorotate dehydrogenase
−
* molecular weight:
+
* ec number:
−
** 608.935   
+
** [http://enzyme.expasy.org/EC/1.3.5.2 EC-1.3.5.2]
 
* Synonym(s):
 
* Synonym(s):
−
** divinylprotochlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-5285]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DI-H-OROTATE]][c] '''+''' 1 [[Ubiquinones]][c] '''=>''' 1 [[Ubiquinols]][c] '''+''' 1 [[OROTATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (S)-dihydroorotate[c] '''+''' 1 a ubiquinone[c] '''=>''' 1 an ubiquinol[c] '''+''' 1 orotate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_005670]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-5686]], UMP biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28690 28690]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632]
+
{{#set: common name=dihydroorotate dehydrogenase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.3.5.2}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831]
+
{{#set: gene associated=Ec-27_005670}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: in pathway=PWY-5686}}
−
{{#set: common name=3,8-divinyl protochlorophyllide a}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=608.935    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=divinylprotochlorophyllide}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=RXN-5285}}
+

Latest revision as of 20:47, 21 March 2018

Reaction RXN0-6491

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dihydroorotate dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5686, UMP biosynthesis: PWY-5686
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN0-6491&oldid=29335"