Difference between revisions of "Ec-21 001800"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-21_001800 == * left end position: ** 2888451 * transcription direction: ** NEGATIVE * right end position: ** 2891948 * centisome position: ** 39.1...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_001800 == |
− | * | + | * left end position: |
− | ** | + | ** 2888451 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2891948 |
− | * | + | * centisome position: |
− | ** | + | ** 39.13827 |
* Synonym(s): | * Synonym(s): | ||
+ | ** Esi_0147_0053 | ||
+ | ** Esi0147_0053 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-8340]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-6823]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2888451}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2891948}} | |
− | + | {{#set: centisome position=39.13827 }} | |
− | + | {{#set: common name=Esi_0147_0053|Esi0147_0053}} | |
− | + | {{#set: reaction associated=RXN-8340}} | |
− | + | {{#set: pathway associated=PWY-6823}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:47, 21 March 2018
Gene Ec-21_001800
- left end position:
- 2888451
- transcription direction:
- NEGATIVE
- right end position:
- 2891948
- centisome position:
- 39.13827
- Synonym(s):
- Esi_0147_0053
- Esi0147_0053
Reactions associated
- Reaction: RXN-8340
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome