Difference between revisions of "CPD-1083"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-12_004890 == * left end position: ** 4510169 * transcription direction: ** POSITIVE * right end position: ** 4512566 * centisome position: ** 54.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == * smiles: ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1083 CPD-1083] == |
− | * | + | * smiles: |
− | ** | + | ** CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J |
− | * | + | * common name: |
− | ** | + | ** (E)-2-methylcrotonoyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 845.604 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** methylcrotonyl-CoA |
− | ** | + | ** trans-2-methylbut-2-enoyl-CoA |
− | ** | + | ** 2-methylbut-2-enoyl-CoA |
+ | ** tigloyl-CoA | ||
+ | ** tiglyl-CoA | ||
+ | ** 2-methyl-crotonyl-CoA | ||
+ | ** (E)-2-methylbut-2-enoyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[TIGLYLCOA-HYDROXY-RXN]] | |
− | + | * [[RXN-14266]] | |
− | * [[ | + | * [[2-METHYLACYL-COA-DEHYDROGENASE-RXN]] |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 6247-62-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266534 45266534] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15478 15478] |
− | {{#set: reaction associated= | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03345 C03345] | |
+ | * HMDB : HMDB02054 | ||
+ | {{#set: smiles=CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J}} | ||
+ | {{#set: common name=(E)-2-methylcrotonoyl-CoA}} | ||
+ | {{#set: molecular weight=845.604 }} | ||
+ | {{#set: common name=methylcrotonyl-CoA|trans-2-methylbut-2-enoyl-CoA|2-methylbut-2-enoyl-CoA|tigloyl-CoA|tiglyl-CoA|2-methyl-crotonyl-CoA|(E)-2-methylbut-2-enoyl-CoA}} | ||
+ | {{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|RXN-14266|2-METHYLACYL-COA-DEHYDROGENASE-RXN}} |
Latest revision as of 20:47, 21 March 2018
Contents
Metabolite CPD-1083
- smiles:
- CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=PMWATMXOQQZNBX-DKBZLLMOSA-J
- common name:
- (E)-2-methylcrotonoyl-CoA
- molecular weight:
- 845.604
- Synonym(s):
- methylcrotonyl-CoA
- trans-2-methylbut-2-enoyl-CoA
- 2-methylbut-2-enoyl-CoA
- tigloyl-CoA
- tiglyl-CoA
- 2-methyl-crotonyl-CoA
- (E)-2-methylbut-2-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.