Difference between revisions of "Propionyl-CoA-CO2-ligases"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] == * common name: ** [propionyl-CoA:carbon...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Propionyl-CoA-CO2-ligases Propionyl-CoA-CO2-ligases] ==
* smiles:
+
** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
+
* inchi key:
+
** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
+
 
* common name:
 
* common name:
** 3-cis-dodecenoyl-CoA
+
** [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
* molecular weight:
+
** 943.792   
+
 
* Synonym(s):
 
* Synonym(s):
** 12:1(n-9)
 
** 12:1 cis-3
 
** cis-3-dodecenoyl-CoA
 
** (3Z)-dodecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[6.3.4.10-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-7931]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=[propionyl-CoA:carbon-dioxide ligase (ADP-forming)]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197]
+
{{#set: produced by=6.3.4.10-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944]
+
* HMDB : HMDB04257
+
{{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}}
+
{{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}}
+
{{#set: common name=3-cis-dodecenoyl-CoA}}
+
{{#set: molecular weight=943.792    }}
+
{{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}}
+
{{#set: consumed or produced by=RXN-7931}}
+

Latest revision as of 19:48, 21 March 2018

Metabolite Propionyl-CoA-CO2-ligases

  • common name:
    • [propionyl-CoA:carbon-dioxide ligase (ADP-forming)]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links