Difference between revisions of "GLUCONATE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9558 RXN-9558] == * direction: ** LEFT-TO-RIGHT * common name: ** Glucose/ribitol dehydrogenase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** D-gluconate |
− | * | + | * molecular weight: |
− | ** | + | ** 195.149 |
* Synonym(s): | * Synonym(s): | ||
+ | ** D-gluconic acid | ||
+ | ** dextronic acid | ||
+ | ** maltonic acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GLUCONOLACT-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * CAS : 526-95-4 | |
− | + | * BIGG : 34420 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419706 6419706] |
− | {{#set: | + | * HMDB : HMDB00625 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00257 C00257] |
− | {{#set: | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.4925340.html 4925340] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18391 18391] | ||
+ | * METABOLIGHTS : MTBLC18391 | ||
+ | {{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M}} | ||
+ | {{#set: common name=D-gluconate}} | ||
+ | {{#set: molecular weight=195.149 }} | ||
+ | {{#set: common name=D-gluconic acid|dextronic acid|maltonic acid}} | ||
+ | {{#set: produced by=GLUCONOLACT-RXN}} |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite GLUCONATE
- smiles:
- C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
- inchi key:
- InChIKey=RGHNJXZEOKUKBD-SQOUGZDYSA-M
- common name:
- D-gluconate
- molecular weight:
- 195.149
- Synonym(s):
- D-gluconic acid
- dextronic acid
- maltonic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 526-95-4
- BIGG : 34420
- PUBCHEM:
- HMDB : HMDB00625
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18391
"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.