Difference between revisions of "Ec-06 003440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Ec-06_003440 == * left end position: ** 2824049 * transcription direction: ** POSITIVE * right end position: ** 2835426 * centisome position: ** 32.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14426 CPD-14426] ==
+
== Gene Ec-06_003440 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2824049
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** docosapentaenoyl-CoA
+
** 2835426
−
* molecular weight:
+
* centisome position:
−
** 1075.997    
+
** 32.246254    
 
* Synonym(s):
 
* Synonym(s):
−
** (7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA
+
** Esi_0064_0020
−
** (7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA
+
** Esi0064_0020
 +
** MSDH
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16082]]
+
* Reaction: [[1.2.1.27-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-13445]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-11213]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-2902]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7574]]
 +
* [[P562-PWY]]
 +
* [[BETA-ALA-DEGRADATION-I-PWY]]
 +
* [[PWY-1781]]
 +
* [[VALDEG-PWY]]
 +
* [[PWY-5642]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2824049}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581114 71581114]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2835426}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73870 73870]
+
{{#set: centisome position=32.246254   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=Esi_0064_0020|Esi0064_0020|MSDH}}
−
{{#set: inchi key=InChIKey=NDRVWKXEWNMEEO-HVGANWHPSA-J}}
+
{{#set: reaction associated=1.2.1.27-RXN|RXN-11213|RXN-2902}}
−
{{#set: common name=docosapentaenoyl-CoA}}
+
{{#set: pathway associated=PWY-7574|P562-PWY|BETA-ALA-DEGRADATION-I-PWY|PWY-1781|VALDEG-PWY|PWY-5642}}
−
{{#set: molecular weight=1075.997   }}
+
−
{{#set: common name=(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyl-CoA|(7Z,10Z,13Z,16Z,19Z)-docosapentaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16082}}
+
−
{{#set: produced by=RXN-13445}}
+

Latest revision as of 19:48, 21 March 2018

Gene Ec-06_003440

  • left end position:
    • 2824049
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2835426
  • centisome position:
    • 32.246254
  • Synonym(s):
    • Esi_0064_0020
    • Esi0064_0020
    • MSDH

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_003440&oldid=29411"