Difference between revisions of "OH-ACYL-ACP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-ACYL-ACP OH-ACYL-ACP] == * common name: ** a (3R)-3-hydroxyacyl-[acyl-carrier protein] * Syn...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-ACYL-ACP OH-ACYL-ACP] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a (3R)-3-hydroxyacyl-[acyl-carrier protein] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a beta-hydroxyacyl-acp |
− | ** | + | ** (3R)-3-hydroxyacyl-[acyl-carrier protein] |
− | ** | + | ** CH3(CH2)xCHOHCH2CO-S-ACP |
+ | ** beta-OH-acyl-ACP | ||
+ | ** beta-hydroxy-acyl-ACP | ||
+ | ** a (3R)-3-hydroxyacyl-[acp] | ||
+ | ** a beta-hydroxyacyl-[acp] | ||
+ | ** a D-3-hydroxy-acyl-[acp] | ||
+ | ** a β-OH-acyl-[acp] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[3-OXOACYL-ACP-REDUCT-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a (3R)-3-hydroxyacyl-[acyl-carrier protein]}} | |
− | + | {{#set: common name=a beta-hydroxyacyl-acp|(3R)-3-hydroxyacyl-[acyl-carrier protein]|CH3(CH2)xCHOHCH2CO-S-ACP|beta-OH-acyl-ACP|beta-hydroxy-acyl-ACP|a (3R)-3-hydroxyacyl-[acp]|a beta-hydroxyacyl-[acp]|a D-3-hydroxy-acyl-[acp]|a β-OH-acyl-[acp]}} | |
− | + | {{#set: produced by=3-OXOACYL-ACP-REDUCT-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: produced by= | + |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite OH-ACYL-ACP
- common name:
- a (3R)-3-hydroxyacyl-[acyl-carrier protein]
- Synonym(s):
- a beta-hydroxyacyl-acp
- (3R)-3-hydroxyacyl-[acyl-carrier protein]
- CH3(CH2)xCHOHCH2CO-S-ACP
- beta-OH-acyl-ACP
- beta-hydroxy-acyl-ACP
- a (3R)-3-hydroxyacyl-[acp]
- a beta-hydroxyacyl-[acp]
- a D-3-hydroxy-acyl-[acp]
- a β-OH-acyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a (3R)-3-hydroxyacyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "(3R)-3-hydroxyacyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
- "a (3R)-3-hydroxyacyl-[acp" cannot be used as a page name in this wiki.
- "a beta-hydroxyacyl-[acp" cannot be used as a page name in this wiki.
- "a D-3-hydroxy-acyl-[acp" cannot be used as a page name in this wiki.
- "a β-OH-acyl-[acp" cannot be used as a page name in this wiki.