Difference between revisions of "CPD-8990"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == * smiles: ** CS(=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=QEFRNWWLZK...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8990 CPD-8990] == |
* smiles: | * smiles: | ||
− | ** | + | ** CS(=O)CCC([N+])C(=O)[O-] |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N |
* common name: | * common name: | ||
− | ** | + | ** L-methionine-(R)-S-oxide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 165.207 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-methionine-R-sulfoxide |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.4.14-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11862103 11862103] |
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58773 58773] |
− | * | + | * BIGG : 2217370 |
− | + | {{#set: smiles=CS(=O)CCC([N+])C(=O)[O-]}} | |
− | {{#set: smiles= | + | {{#set: inchi key=InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-methionine-(R)-S-oxide}} |
− | {{#set: common name= | + | {{#set: molecular weight=165.207 }} |
− | {{#set: molecular weight= | + | {{#set: common name=L-methionine-R-sulfoxide}} |
− | {{#set: common name= | + | {{#set: consumed by=1.8.4.14-RXN}} |
− | {{#set: consumed by= | + | |
− | + |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite CPD-8990
- smiles:
- CS(=O)CCC([N+])C(=O)[O-]
- inchi key:
- InChIKey=QEFRNWWLZKMPFJ-ZXPFJRLXSA-N
- common name:
- L-methionine-(R)-S-oxide
- molecular weight:
- 165.207
- Synonym(s):
- L-methionine-R-sulfoxide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CS(=O)CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.