Difference between revisions of "ALPHA-GLC-6-P"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-22_000030 == * Synonym(s): ** Esi_0437_0005 ** Esi0437_0005 ** ALG8 == Reactions associated == * RXN-15117 ** pantograph-aragem == Pa...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-GLC-6-P ALPHA-GLC-6-P] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ||
| + | * inchi key: | ||
| + | ** InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L | ||
| + | * common name: | ||
| + | ** α-D-glucose 6-phosphate | ||
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-glucose 6-phosphate |
| − | ** | + | ** α-D-glucose-6-P |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.4.1.36-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| + | * [[RXN-761]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: reaction associated=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21604864 21604864] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10239175.html 10239175] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58225 58225] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00668 C00668] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
| + | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L}} | ||
| + | {{#set: common name=α-D-glucose 6-phosphate}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: common name=α-glucose 6-phosphate|α-D-glucose-6-P}} | ||
| + | {{#set: consumed by=2.4.1.36-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-761}} | ||
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite ALPHA-GLC-6-P
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-DVKNGEFBSA-L
- common name:
- α-D-glucose 6-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- α-glucose 6-phosphate
- α-D-glucose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
