Difference between revisions of "Unsulfurated-Sulfur-Acceptors"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] == * common name: ** an unsulfurat...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an unsulfurated [sulfur carrier] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** an unsulfurated [sulfur donor] |
− | ** | + | ** an unsulfurated [sulfur acceptor] |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12588]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-5063]] |
+ | * [[2.8.1.6-RXN]] | ||
+ | * [[RXN0-6359]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14480]] | ||
+ | * [[RXN-17472]] | ||
+ | * [[RXN-12587]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=an unsulfurated [sulfur carrier]}} | |
− | + | {{#set: common name=an unsulfurated [sulfur donor]|an unsulfurated [sulfur acceptor]}} | |
− | + | {{#set: consumed by=RXN-12588}} | |
− | + | {{#set: produced by=RXN0-5063|2.8.1.6-RXN|RXN0-6359}} | |
− | + | {{#set: reversible reaction associated=RXN-14480|RXN-17472|RXN-12587}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:48, 21 March 2018
Contents
Metabolite Unsulfurated-Sulfur-Acceptors
- common name:
- an unsulfurated [sulfur carrier]
- Synonym(s):
- an unsulfurated [sulfur donor]
- an unsulfurated [sulfur acceptor]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"an unsulfurated [sulfur carrier" cannot be used as a page name in this wiki.
- "an unsulfurated [sulfur donor" cannot be used as a page name in this wiki.
- "an unsulfurated [sulfur acceptor" cannot be used as a page name in this wiki.