Difference between revisions of "Unsulfurated-Sulfur-Acceptors"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * inchi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] == * common name: ** an unsulfurat...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unsulfurated-Sulfur-Acceptors Unsulfurated-Sulfur-Acceptors] ==
−
* smiles:
+
−
** CC(=O)C(O)COP(=O)([O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
+
 
* common name:
 
* common name:
−
** 1-deoxy-L-glycero-tetrulose 4-phosphate
+
** an unsulfurated [sulfur carrier]
−
* molecular weight:
+
−
** 182.069   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3,4-dihydroxy-2-butanone-4-phosphate
+
** an unsulfurated [sulfur donor]
−
** tetrolose phosphate
+
** an unsulfurated [sulfur acceptor]
−
** 3,4-dihydroxy-2-butanone-4-P
+
−
** L-3,4-dihydroxybutan-2-one-4-phosphate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[LUMAZINESYN-RXN]]
+
* [[RXN-12588]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[DIOHBUTANONEPSYN-RXN]]
+
* [[RXN0-5063]]
 +
* [[2.8.1.6-RXN]]
 +
* [[RXN0-6359]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[RXN-14480]]
 +
* [[RXN-17472]]
 +
* [[RXN-12587]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an unsulfurated [sulfur carrier]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385]
+
{{#set: common name=an unsulfurated [sulfur donor]|an unsulfurated [sulfur acceptor]}}
−
* CHEMSPIDER:
+
{{#set: consumed by=RXN-12588}}
−
** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351]
+
{{#set: produced by=RXN0-5063|2.8.1.6-RXN|RXN0-6359}}
−
* CHEBI:
+
{{#set: reversible reaction associated=RXN-14480|RXN-17472|RXN-12587}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606]
+
−
* BIGG : 199371
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556]
+
−
{{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}}
+
−
{{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}}
+
−
{{#set: molecular weight=182.069    }}
+
−
{{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}}
+
−
{{#set: consumed by=LUMAZINESYN-RXN}}
+
−
{{#set: produced by=DIOHBUTANONEPSYN-RXN}}
+

Latest revision as of 19:48, 21 March 2018

Metabolite Unsulfurated-Sulfur-Acceptors

  • common name:
    • an unsulfurated [sulfur carrier]
  • Synonym(s):
    • an unsulfurated [sulfur donor]
    • an unsulfurated [sulfur acceptor]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an unsulfurated [sulfur carrier" cannot be used as a page name in this wiki.
  • "an unsulfurated [sulfur donor" cannot be used as a page name in this wiki.
  • "an unsulfurated [sulfur acceptor" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Unsulfurated-Sulfur-Acceptors&oldid=29462"