Difference between revisions of "RXN-1102"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1102 RXN-1102] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1102 RXN-1102] ==
* smiles:
+
* direction:
** CC1(NC(=O)NC1CCCCCC(=O)[O-])
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/1.1.1.195 EC-1.1.1.195]
* common name:
+
** dethiobiotin
+
* molecular weight:
+
** 213.256   
+
 
* Synonym(s):
 
* Synonym(s):
** desthiobiotin
 
** DTB
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[2.8.1.6-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[COUMARALDEHYDE]][c] '''=>''' 1 [[COUMARYL-ALCOHOL]][c] '''+''' 1 [[NADP]][c]
* [[DETHIOBIOTIN-SYN-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 4-coumaraldehyde[c] '''=>''' 1 4-coumaryl alcohol[c] '''+''' 1 NADP+[c]
* [[RXN-17472]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-18_002860]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
 +
** '''7''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 533-48-2
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R07437 R07437]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917]
+
{{#set: direction=LEFT-TO-RIGHT}}
* HMDB : HMDB03581
+
{{#set: ec number=EC-1.1.1.195}}
* LIGAND-CPD:
+
{{#set: gene associated=Ec-18_002860}}
** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909]
+
{{#set: in pathway=PWY-361}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861]
+
{{#set: reconstruction source=orthology-aragem}}
* BIGG : 38667
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}}
+
{{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}}
+
{{#set: common name=dethiobiotin}}
+
{{#set: molecular weight=213.256    }}
+
{{#set: common name=desthiobiotin|DTB}}
+
{{#set: consumed by=2.8.1.6-RXN}}
+
{{#set: produced by=DETHIOBIOTIN-SYN-RXN}}
+
{{#set: reversible reaction associated=RXN-17472}}
+

Latest revision as of 19:48, 21 March 2018

Reaction RXN-1102

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-361, phenylpropanoid biosynthesis: PWY-361
    • 7 reactions found over 15 reactions in the full pathway

Reconstruction information

External links