Difference between revisions of "DETHIOBIOTIN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN] == * direction: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) |
| + | * inchi key: | ||
| + | ** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** dethiobiotin |
| − | * | + | * molecular weight: |
| − | ** | + | ** 213.256 |
* Synonym(s): | * Synonym(s): | ||
| + | ** desthiobiotin | ||
| + | ** DTB | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[2.8.1.6-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[DETHIOBIOTIN-SYN-RXN]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-17472]] | |
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * CAS : 533-48-2 |
| − | ** [http:// | + | * PUBCHEM: |
| − | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917] |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB03581 |
| − | ** [http://www. | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861] |
| − | {{#set: | + | * BIGG : 38667 |
| − | {{#set: | + | {{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=dethiobiotin}} |
| − | {{#set: | + | {{#set: molecular weight=213.256 }} |
| + | {{#set: common name=desthiobiotin|DTB}} | ||
| + | {{#set: consumed by=2.8.1.6-RXN}} | ||
| + | {{#set: produced by=DETHIOBIOTIN-SYN-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-17472}} | ||
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite DETHIOBIOTIN
- smiles:
- CC1(NC(=O)NC1CCCCCC(=O)[O-])
- inchi key:
- InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
- common name:
- dethiobiotin
- molecular weight:
- 213.256
- Synonym(s):
- desthiobiotin
- DTB
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(NC(=O)NC1CCCCCC(=O)[O-])" cannot be used as a page name in this wiki.
