Difference between revisions of "Ec-21 003440"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Ec-21_003440 == * left end position: ** 4397248 * transcription direction: ** NEGATIVE * right end position: ** 4405738 * centisome position: ** 59.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003440 == |
− | * | + | * left end position: |
− | ** | + | ** 4397248 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4405738 |
− | * | + | * centisome position: |
− | ** | + | ** 59.582348 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0072_0062 |
− | ** | + | ** Esi0072_0062 |
− | == | + | == Reactions associated == |
− | * [[2. | + | * Reaction: [[2.1.1.77-RXN]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
− | == | + | == Pathways associated == |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4397248}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4405738}} | |
− | + | {{#set: centisome position=59.582348 }} | |
− | + | {{#set: common name=Esi_0072_0062|Esi0072_0062}} | |
− | + | {{#set: reaction associated=2.1.1.77-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:48, 21 March 2018
Gene Ec-21_003440
- left end position:
- 4397248
- transcription direction:
- NEGATIVE
- right end position:
- 4405738
- centisome position:
- 59.582348
- Synonym(s):
- Esi_0072_0062
- Esi0072_0062
Reactions associated
- Reaction: 2.1.1.77-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome