Difference between revisions of "Ec-21 003440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...")
 
(Created page with "Category:Gene == Gene Ec-21_003440 == * left end position: ** 4397248 * transcription direction: ** NEGATIVE * right end position: ** 4405738 * centisome position: ** 59.5...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] ==
+
== Gene Ec-21_003440 ==
* smiles:
+
* left end position:
** CC1(NC(=O)NC1CCCCCC(=O)[O-])
+
** 4397248
* inchi key:
+
* transcription direction:
** InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** dethiobiotin
+
** 4405738
* molecular weight:
+
* centisome position:
** 213.256    
+
** 59.582348    
 
* Synonym(s):
 
* Synonym(s):
** desthiobiotin
+
** Esi_0072_0062
** DTB
+
** Esi0072_0062
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[2.8.1.6-RXN]]
+
* Reaction: [[2.1.1.77-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
* [[DETHIOBIOTIN-SYN-RXN]]
+
*** Assignment: go-term
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
* [[RXN-17472]]
+
 
== External links  ==
 
== External links  ==
* CAS : 533-48-2
+
{{#set: left end position=4397248}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244917 25244917]
+
{{#set: right end position=4405738}}
* HMDB : HMDB03581
+
{{#set: centisome position=59.582348   }}
* LIGAND-CPD:
+
{{#set: common name=Esi_0072_0062|Esi0072_0062}}
** [http://www.genome.jp/dbget-bin/www_bget?C01909 C01909]
+
{{#set: reaction associated=2.1.1.77-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57861 57861]
+
* BIGG : 38667
+
{{#set: smiles=CC1(NC(=O)NC1CCCCCC(=O)[O-])}}
+
{{#set: inchi key=InChIKey=AUTOLBMXDDTRRT-UHFFFAOYSA-M}}
+
{{#set: common name=dethiobiotin}}
+
{{#set: molecular weight=213.256   }}
+
{{#set: common name=desthiobiotin|DTB}}
+
{{#set: consumed by=2.8.1.6-RXN}}
+
{{#set: produced by=DETHIOBIOTIN-SYN-RXN}}
+
{{#set: consumed or produced by=RXN-17472}}
+

Latest revision as of 20:48, 21 March 2018

Gene Ec-21_003440

  • left end position:
    • 4397248
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4405738
  • centisome position:
    • 59.582348
  • Synonym(s):
    • Esi_0072_0062
    • Esi0072_0062

Reactions associated

Pathways associated

External links