Difference between revisions of "Ec-07 002870"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
(Created page with "Category:Gene == Gene Ec-07_002870 == * left end position: ** 3080445 * transcription direction: ** POSITIVE * right end position: ** 3083396 * centisome position: ** 39.8...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
+
== Gene Ec-07_002870 ==
−
* smiles:
+
* left end position:
−
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
+
** 3080445
−
* inchi key:
+
* transcription direction:
−
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** phenylacetylglycine
+
** 3083396
−
* molecular weight:
+
* centisome position:
−
** 192.194    
+
** 39.88958    
 
* Synonym(s):
 
* Synonym(s):
−
** phenaceturic acid
+
** Esi_0261_0032
−
** phenacetylglycine
+
** Esi0261_0032
−
** N-phenacetylglycine
+
** SDH4
−
** N-phenylacetylglycine
+
−
** N-(phenylacetyl)glycine
+
−
** glycine, N-(phenylacetyl)-
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-14971]]
−
* [[RXN-10821]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[RXN-15378]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-561]]
 +
* [[PWY0-1353]]
 +
* [[PWY-3781]]
 +
* [[PWY66-398]]
 +
* [[PWY-7279]]
 +
* [[P105-PWY]]
 +
* [[PWY-6969]]
 +
* [[PWY-6728]]
 +
* [[PWY0-1329]]
 +
* [[PWY-7254]]
 +
* [[TCA]]
 +
* [[PWY-4302]]
 +
* [[PWY-5690]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3080445}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=3083396}}
−
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
+
{{#set: centisome position=39.88958   }}
−
* CHEBI:
+
{{#set: common name=Esi_0261_0032|Esi0261_0032|SDH4}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
+
{{#set: reaction associated=RXN-14971|RXN-15378|SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN}}
−
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
+
{{#set: pathway associated=PWY-561|PWY0-1353|PWY-3781|PWY66-398|PWY-7279|P105-PWY|PWY-6969|PWY-6728|PWY0-1329|PWY-7254|TCA|PWY-4302|PWY-5690}}
−
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
+
−
{{#set: common name=phenylacetylglycine}}
+
−
{{#set: molecular weight=192.194   }}
+
−
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
+
−
{{#set: produced by=RXN-10821}}
+

Latest revision as of 20:49, 21 March 2018

Gene Ec-07_002870

  • left end position:
    • 3080445
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3083396
  • centisome position:
    • 39.88958
  • Synonym(s):
    • Esi_0261_0032
    • Esi0261_0032
    • SDH4

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_002870&oldid=29494"