Difference between revisions of "Ec-07 002070"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2...")
 
(Created page with "Category:Gene == Gene Ec-07_002070 == * left end position: ** 2260578 * transcription direction: ** POSITIVE * right end position: ** 2265653 * centisome position: ** 29.2...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] ==
+
== Gene Ec-07_002070 ==
−
* smiles:
+
* left end position:
−
** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))
+
** 2260578
−
* inchi key:
+
* transcription direction:
−
** InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** GDP-α-D-mannuronate
+
** 2265653
−
* molecular weight:
+
* centisome position:
−
** 616.305    
+
** 29.272884    
 
* Synonym(s):
 
* Synonym(s):
−
** GDP-mannuronic acid
+
** Esi_0061_0053
−
** GDP-α-D-mannuronic acid
+
** Esi0061_0053
−
** GDP-mannuronate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.1.1.39-RXN]]
−
* [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
* Reaction: [[OXALODECARB-RXN]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-3641]]
 +
* [[GLUCONEO-PWY]]
 +
* [[PWY-7384]]
 +
* [[P184-PWY]]
 +
* [[METHYLGALLATE-DEGRADATION-PWY]]
 +
* [[PWY-7686]]
 +
* [[PWY-7115]]
 +
* [[PWY-7118]]
 +
* [[PWY-6339]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2260578}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966153 11966153]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=2265653}}
−
** [http://www.chemspider.com/Chemical-Structure.10140147.html 10140147]
+
{{#set: centisome position=29.272884   }}
−
* CHEBI:
+
{{#set: common name=Esi_0061_0053|Esi0061_0053}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17466 17466]
+
{{#set: reaction associated=1.1.1.39-RXN|OXALODECARB-RXN}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-3641|GLUCONEO-PWY|PWY-7384|P184-PWY|METHYLGALLATE-DEGRADATION-PWY|PWY-7686|PWY-7115|PWY-7118|PWY-6339}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00976 C00976]
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))}}
+
−
{{#set: inchi key=InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K}}
+
−
{{#set: common name=GDP-α-D-mannuronate}}
+
−
{{#set: molecular weight=616.305   }}
+
−
{{#set: common name=GDP-mannuronic acid|GDP-α-D-mannuronic acid|GDP-mannuronate}}
+
−
{{#set: produced by=GDP-MANNOSE-6-DEHYDROGENASE-RXN}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-07_002070

  • left end position:
    • 2260578
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2265653
  • centisome position:
    • 29.272884
  • Synonym(s):
    • Esi_0061_0053
    • Esi0061_0053

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-07_002070&oldid=29501"