Difference between revisions of "CPD-11715"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3-OXOACYL-ACP-REDUCT-RXN 3-OXOACYL-ACP-REDUCT-RXN] == * direction: ** LEFT-TO-RIGHT * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == |
− | * | + | * smiles: |
− | ** | + | ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) |
+ | * inchi key: | ||
+ | ** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** phenylacetylglycine |
− | * | + | * molecular weight: |
− | ** | + | ** 192.194 |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** phenaceturic acid | ||
+ | ** phenacetylglycine | ||
+ | ** N-phenacetylglycine | ||
+ | ** N-phenylacetylglycine | ||
+ | ** N-(phenylacetyl)glycine | ||
+ | ** glycine, N-(phenylacetyl)- | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10821]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702] |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658] | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874] |
− | ** [http://www. | + | {{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}} |
− | + | {{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}} | |
− | * | + | {{#set: common name=phenylacetylglycine}} |
− | ** [http://www. | + | {{#set: molecular weight=192.194 }} |
− | + | {{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}} | |
− | + | {{#set: produced by=RXN-10821}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-11715
- smiles:
- C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
- inchi key:
- InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
- common name:
- phenylacetylglycine
- molecular weight:
- 192.194
- Synonym(s):
- phenaceturic acid
- phenacetylglycine
- N-phenacetylglycine
- N-phenylacetylglycine
- N-(phenylacetyl)glycine
- glycine, N-(phenylacetyl)-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)" cannot be used as a page name in this wiki.