Difference between revisions of "CPD-14893"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_002070 == * left end position: ** 2260578 * transcription direction: ** POSITIVE * right end position: ** 2265653 * centisome position: ** 29.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N |
| − | * | + | * common name: |
| − | ** | + | ** ergost-7-enol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 400.687 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13883]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CAS : 516-78-9 | |
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657800 90657800] |
| − | {{#set: | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}} |
| − | {{#set: | + | {{#set: common name=ergost-7-enol}} |
| − | {{#set: | + | {{#set: molecular weight=400.687 }} |
| + | {{#set: consumed by=RXN-13883}} | ||
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite CPD-14893
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
- common name:
- ergost-7-enol
- molecular weight:
- 400.687
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 516-78-9
- PUBCHEM:
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
