Difference between revisions of "Ec-14 003840"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
(Created page with "Category:Gene == Gene Ec-14_003840 == * left end position: ** 3573679 * transcription direction: ** NEGATIVE * right end position: ** 3580251 * centisome position: ** 54.4...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] ==
+
== Gene Ec-14_003840 ==
−
* smiles:
+
* left end position:
−
** CC1(OC(C(C(C1O)O)O)O)
+
** 3573679
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** α-L-fucopyranose
+
** 3580251
−
* molecular weight:
+
* centisome position:
−
** 164.158    
+
** 54.47326    
 
* Synonym(s):
 
* Synonym(s):
−
** α-L-fucose
+
** Esi_0286_0013
 +
** Esi0286_0013
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.223-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN0-5298]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 +
* [[PWY-6558]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04473
+
{{#set: left end position=3573679}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439554 439554]
+
{{#set: right end position=3580251}}
−
* HMDB : HMDB00174
+
{{#set: centisome position=54.47326   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0286_0013|Esi0286_0013}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
+
{{#set: reaction associated=2.4.1.223-RXN}}
−
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-6558}}
−
** [http://www.chemspider.com/Chemical-Structure.388645.html 388645]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42548 42548]
+
−
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
+
−
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N}}
+
−
{{#set: common name=α-L-fucopyranose}}
+
−
{{#set: molecular weight=164.158   }}
+
−
{{#set: common name=α-L-fucose}}
+
−
{{#set: consumed or produced by=RXN0-5298}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-14_003840

  • left end position:
    • 3573679
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3580251
  • centisome position:
    • 54.47326
  • Synonym(s):
    • Esi_0286_0013
    • Esi0286_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-14_003840&oldid=29515"