Difference between revisions of "Cis-delta17-3-oxo-C36-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta17-3-oxo-C36-ACPs cis-delta17-3-oxo-C36-ACPs] == * common name: ** a cis-delta17-3-oxo...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-delta17-3-oxo-C36-ACPs cis-delta17-3-oxo-C36-ACPs] ==
−
* smiles:
+
−
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
+
−
* inchi key:
+
−
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** phenylacetylglycine
+
** a cis-delta17-3-oxo-C36:1-[acp]
−
* molecular weight:
+
−
** 192.194   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phenaceturic acid
 
−
** phenacetylglycine
 
−
** N-phenacetylglycine
 
−
** N-phenylacetylglycine
 
−
** N-(phenylacetyl)glycine
 
−
** glycine, N-(phenylacetyl)-
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1G-881]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10821]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a cis-delta17-3-oxo-C36:1-[acp]}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
+
{{#set: consumed by=RXN1G-881}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
+
−
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
+
−
{{#set: common name=phenylacetylglycine}}
+
−
{{#set: molecular weight=192.194    }}
+
−
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
+
−
{{#set: produced by=RXN-10821}}
+

Latest revision as of 19:49, 21 March 2018

Metabolite cis-delta17-3-oxo-C36-ACPs

  • common name:
    • a cis-delta17-3-oxo-C36:1-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis-delta17-3-oxo-C36:1-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Cis-delta17-3-oxo-C36-ACPs&oldid=29522"