Difference between revisions of "1-Alkyl-glycerol-3-phosphate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-glycerol-3-phosphate 1-Alkyl-glycerol-3-phosphate] == * common name: ** a 1-alkyl-sn-gl...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-glycerol-3-phosphate 1-Alkyl-glycerol-3-phosphate] ==
−
* smiles:
+
−
** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J
+
 
* common name:
 
* common name:
−
** 1,3-bisphospho-D-glycerate
+
** a 1-alkyl-sn-glycerol 3-phosphate
−
* molecular weight:
+
−
** 262.006   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-phospho-D-glyceroyl-phosphate
 
−
** 3-phosphoglyceroyl-P
 
−
** P-glyceroyl-P
 
−
** phosphoglyceroyl-P
 
−
** 3-phosphoglyceroyl-phosphate
 
−
** 3-P-glyceroyl-P
 
−
** DPG
 
−
** 13-DPG
 
−
** glycerate 1,3-bisphosphate
 
−
** 3-phosphonato-D-glyceroyl phosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[1.2.1.13-RXN]]
+
* [[RXN-17729]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[GAPOXNPHOSPHN-RXN]]
 
−
* [[PHOSGLYPHOS-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 1981-49-3
+
{{#set: common name=a 1-alkyl-sn-glycerol 3-phosphate}}
−
* BIGG : 34342
+
{{#set: consumed by=RXN-17729}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878409 46878409]
+
−
* HMDB : HMDB01270
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00236 C00236]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.19698372.html 19698372]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57604 57604]
+
−
* METABOLIGHTS : MTBLC57604
+
−
{{#set: smiles=C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LJQLQCAXBUHEAZ-UWTATZPHSA-J}}
+
−
{{#set: common name=1,3-bisphospho-D-glycerate}}
+
−
{{#set: molecular weight=262.006    }}
+
−
{{#set: common name=3-phospho-D-glyceroyl-phosphate|3-phosphoglyceroyl-P|P-glyceroyl-P|phosphoglyceroyl-P|3-phosphoglyceroyl-phosphate|3-P-glyceroyl-P|DPG|13-DPG|glycerate 1,3-bisphosphate|3-phosphonato-D-glyceroyl phosphate}}
+
−
{{#set: consumed by=1.2.1.13-RXN}}
+
−
{{#set: reversible reaction associated=GAPOXNPHOSPHN-RXN|PHOSGLYPHOS-RXN}}
+

Latest revision as of 20:49, 21 March 2018

Metabolite 1-Alkyl-glycerol-3-phosphate

  • common name:
    • a 1-alkyl-sn-glycerol 3-phosphate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=1-Alkyl-glycerol-3-phosphate&oldid=29527"