Difference between revisions of "RXN-10706"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10706 RXN-10706] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-CoA oxidase, partial *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10706 RXN-10706] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
+
 
* common name:
 
* common name:
−
** ergost-7-enol
+
** acyl-CoA oxidase, partial
−
* molecular weight:
+
** Acyl-CoA oxidase/dehydrogenase, central domain
−
** 400.687   
+
** acyl-CoA oxidase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13883]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-11521]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-11522]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 OPC6-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 OPC6-trans-2-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-08_006390]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-26_004320]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-22_002920]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
 +
** '''10''' reactions found over '''19''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 516-78-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=acyl-CoA oxidase, partial}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657800 90657800]
+
{{#set: common name=Acyl-CoA oxidase/dehydrogenase, central domain}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=acyl-CoA oxidase}}
−
{{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}}
+
{{#set: ec number=EC-1.3.3.6}}
−
{{#set: common name=ergost-7-enol}}
+
{{#set: gene associated=Ec-08_006390|Ec-26_004320|Ec-22_002920}}
−
{{#set: molecular weight=400.687    }}
+
{{#set: in pathway=PWY-735}}
−
{{#set: consumed by=RXN-13883}}
+
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-esiliculosus_genome}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 19:49, 21 March 2018

Reaction RXN-10706

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-CoA oxidase, partial
    • Acyl-CoA oxidase/dehydrogenase, central domain
    • acyl-CoA oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-735, jasmonic acid biosynthesis: PWY-735
    • 10 reactions found over 19 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10706&oldid=29531"