Difference between revisions of "Ec-11 002820"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] == * smiles: ** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-...")
(Created page with "Category:Gene == Gene Ec-11_002820 == * left end position: ** 2976247 * transcription direction: ** POSITIVE * right end position: ** 2983203 * centisome position: ** 47.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PSEUDOURIDINE-5-P PSEUDOURIDINE-5-P] ==
+
== Gene Ec-11_002820 ==
−
* smiles:
+
* left end position:
−
** C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))
+
** 2976247
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** pseudouridine 5'-phosphate
+
** 2983203
−
* molecular weight:
+
* centisome position:
−
** 322.168    
+
** 47.319695    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0048_0062
 +
** Esi0048_0062
 +
** IGPS
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[IGPSYN-RXN]]
−
* [[PSEUDOURIDINE-KINASE-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[RXN0-5398]]
+
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1157-60-4
+
{{#set: left end position=2976247}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245232 25245232]
+
{{#set: right end position=2983203}}
−
* CHEBI:
+
{{#set: centisome position=47.319695    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58380 58380]
+
{{#set: common name=Esi_0048_0062|Esi0048_0062|IGPS}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=IGPSYN-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01168 C01168]
+
{{#set: pathway associated=TRPSYN-PWY}}
−
* HMDB : HMDB01271
+
−
{{#set: smiles=C1(=C(C(=O)NC(=O)N1)C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))}}
+
−
{{#set: inchi key=InChIKey=MOBMOJGXNHLLIR-GBNDHIKLSA-L}}
+
−
{{#set: common name=pseudouridine 5'-phosphate}}
+
−
{{#set: molecular weight=322.168    }}
+
−
{{#set: produced by=PSEUDOURIDINE-KINASE-RXN}}
+
−
{{#set: reversible reaction associated=RXN0-5398}}
+

Latest revision as of 19:49, 21 March 2018

Gene Ec-11_002820

  • left end position:
    • 2976247
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2983203
  • centisome position:
    • 47.319695
  • Synonym(s):
    • Esi_0048_0062
    • Esi0048_0062
    • IGPS

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-11_002820&oldid=29537"