Difference between revisions of "RXN-14205"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] == * direction: ** REVERSIBLE * common name: ** Apyrase * ec number: ** [http:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14205 RXN-14205] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Apyrase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CPD0-1905]][c] '''+''' 2 [[WATER]][c] '''<=>''' 1 [[CPD-12365]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c] | |
| − | + | * With common name(s): | |
| − | + | ** 1 8-oxo-dGTP[c] '''+''' 2 H2O[c] '''<=>''' 1 8-oxo-dGMP[c] '''+''' 2 H+[c] '''+''' 2 phosphate[c] | |
| − | + | ||
| − | * [[ | + | == Genes associated with this reaction == |
| − | == | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Ec-02_001970]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| − | == | + | *** Assignment: AUTOMATED-NAME-MATCH |
| − | * [[ | + | == Pathways == |
| − | * [[ | + | == Reconstruction information == |
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-esiliculosus_genome]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Apyrase}} | |
| − | + | {{#set: ec number=EC-3.6.1.5}} | |
| − | + | {{#set: gene associated=Ec-02_001970}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:49, 21 March 2018
Contents
Reaction RXN-14205
- direction:
- REVERSIBLE
- common name:
- Apyrase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 8-oxo-dGTP[c] + 2 H2O[c] <=> 1 8-oxo-dGMP[c] + 2 H+[c] + 2 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-02_001970
- Source: annotation-esiliculosus_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
