Difference between revisions of "RIBULP3EPIM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBULP3EPIM-RXN RIBULP3EPIM-RXN] == * direction: ** REVERSIBLE * common name: ** Ribulose-phosphate...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBULP3EPIM-RXN RIBULP3EPIM-RXN] == |
− | + | * direction: | |
− | + | ** REVERSIBLE | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Ribulose-phosphate 3-epimerase-like |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.1.3.1 EC-5.1.3.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[1 | + | * With identifiers: |
− | * [[ | + | ** 1 [[RIBULOSE-5P]][c] '''<=>''' 1 [[XYLULOSE-5-PHOSPHATE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 D-ribulose 5-phosphate[c] '''<=>''' 1 D-xylulose 5-phosphate[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Ec-07_002390]] |
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | * Gene: [[Ec-27_003930]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | == Pathways == | ||
+ | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY] | ||
+ | ** '''12''' reactions found over '''15''' reactions in the full pathway | ||
+ | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY] | ||
+ | ** '''13''' reactions found over '''13''' reactions in the full pathway | ||
+ | * [[P21-PWY]], pentose phosphate pathway (partial): [http://metacyc.org/META/NEW-IMAGE?object=P21-PWY P21-PWY] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-1861]], formaldehyde assimilation II (RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861] | ||
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY] | ||
+ | ** '''13''' reactions found over '''18''' reactions in the full pathway | ||
+ | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY] | ||
+ | ** '''11''' reactions found over '''12''' reactions in the full pathway | ||
+ | * [[NONOXIPENT-PWY]], pentose phosphate pathway (non-oxidative branch): [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY] | ||
+ | ** '''5''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13677 13677] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01529 R01529] | |
− | ** [http:// | + | * UNIPROT: |
− | + | ** [http://www.uniprot.org/uniprot/P40117 P40117] | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q9CEB9 Q9CEB9] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P0AG07 P0AG07] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PI57 Q9PI57] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JUA9 Q9JUA9] |
− | * | + | ** [http://www.uniprot.org/uniprot/P45455 P45455] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q43157 Q43157] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q43843 Q43843] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P74061 P74061] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O23782 O23782] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P51012 P51012] |
− | {{#set: | + | {{#set: direction=REVERSIBLE}} |
− | {{#set: | + | {{#set: common name=Ribulose-phosphate 3-epimerase-like}} |
− | {{#set: | + | {{#set: ec number=EC-5.1.3.1}} |
− | {{#set: | + | {{#set: gene associated=Ec-07_002390|Ec-27_003930}} |
− | {{#set: | + | {{#set: in pathway=P124-PWY|CALVIN-PWY|P21-PWY|PWY-5723|PWY-1861|P122-PWY|P185-PWY|NONOXIPENT-PWY}} |
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:49, 21 March 2018
Contents
Reaction RIBULP3EPIM-RXN
- direction:
- REVERSIBLE
- common name:
- Ribulose-phosphate 3-epimerase-like
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 RIBULOSE-5P[c] <=> 1 XYLULOSE-5-PHOSPHATE[c]
- With common name(s):
- 1 D-ribulose 5-phosphate[c] <=> 1 D-xylulose 5-phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-07_002390
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
- Gene: Ec-27_003930
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: orthology-aragem
- Source: orthology-aragem
- Source: annotation-esiliculosus_genome
Pathways
- P124-PWY, Bifidobacterium shunt: P124-PWY
- 12 reactions found over 15 reactions in the full pathway
- CALVIN-PWY, Calvin-Benson-Bassham cycle: CALVIN-PWY
- 13 reactions found over 13 reactions in the full pathway
- P21-PWY, pentose phosphate pathway (partial): P21-PWY
- 3 reactions found over 3 reactions in the full pathway
- PWY-5723, Rubisco shunt: PWY-5723
- 10 reactions found over 10 reactions in the full pathway
- PWY-1861, formaldehyde assimilation II (RuMP Cycle): PWY-1861
- 7 reactions found over 9 reactions in the full pathway
- P122-PWY, heterolactic fermentation: P122-PWY
- 13 reactions found over 18 reactions in the full pathway
- P185-PWY, formaldehyde assimilation III (dihydroxyacetone cycle): P185-PWY
- 11 reactions found over 12 reactions in the full pathway
- NONOXIPENT-PWY, pentose phosphate pathway (non-oxidative branch): NONOXIPENT-PWY
- 5 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: