Difference between revisions of "CPD-16817"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13600 RXN-13600] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-glucosidase, family GH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) |
| + | * inchi key: | ||
| + | ** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** indoxyl sulfate |
| − | * | + | * molecular weight: |
| − | + | ** 212.2 | |
| − | + | ||
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| + | ** indol-3-yl sulfate | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-15587]] | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098] | |
| − | + | * CHEBI: | |
| − | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] | |
| − | {{#set: | + | * HMDB : HMDB00682 |
| − | {{#set: | + | {{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: common name=indoxyl sulfate}} |
| − | {{#set: | + | {{#set: molecular weight=212.2 }} |
| − | {{#set: | + | {{#set: common name=indol-3-yl sulfate}} |
| + | {{#set: reversible reaction associated=RXN-15587}} | ||
Latest revision as of 20:49, 21 March 2018
Contents
Metabolite CPD-16817
- smiles:
- C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
- inchi key:
- InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
- common name:
- indoxyl sulfate
- molecular weight:
- 212.2
- Synonym(s):
- indol-3-yl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.
