Difference between revisions of "BIO-5-AMP"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] == * common name: ** a (7Z)-3-oxo-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7Z-3-oxo-hexadec-7-enoyl-ACPs 7Z-3-oxo-hexadec-7-enoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] ==
 +
* smiles:
 +
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
 +
* inchi key:
 +
** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
 
* common name:
 
* common name:
** a (7Z)-3-oxo-hexadec-7-enoyl-[acp]
+
** biotinyl-5'-adenylate
 +
* molecular weight:
 +
** 572.509   
 
* Synonym(s):
 
* Synonym(s):
 +
** biotinyl-5'-AMP
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16622]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16621]]
+
* [[RXN0-7192]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a (7Z)-3-oxo-hexadec-7-enoyl-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-16622}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798]
{{#set: produced by=RXN-16621}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921]
 +
* HMDB : HMDB04220
 +
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}}
 +
{{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}}
 +
{{#set: common name=biotinyl-5'-adenylate}}
 +
{{#set: molecular weight=572.509    }}
 +
{{#set: common name=biotinyl-5'-AMP}}
 +
{{#set: produced by=RXN0-7192}}

Latest revision as of 20:49, 21 March 2018

Metabolite BIO-5-AMP

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
  • inchi key:
    • InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
  • common name:
    • biotinyl-5'-adenylate
  • molecular weight:
    • 572.509
  • Synonym(s):
    • biotinyl-5'-AMP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.