Difference between revisions of "Ec-10 001500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIOTIN BIOTIN] == * smiles: ** C1(SC(CCCCC(=O)[O-])[CH]2(NC(=O)N[CH]12)) * inchi key: ** InChIK...") |
(Created page with "Category:Gene == Gene Ec-10_001500 == * left end position: ** 1558309 * transcription direction: ** NEGATIVE * right end position: ** 1565770 * centisome position: ** 23.9...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_001500 == |
− | * | + | * left end position: |
− | ** | + | ** 1558309 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1565770 |
− | * | + | * centisome position: |
− | ** | + | ** 23.970352 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0073_0128 |
− | ** | + | ** Esi0073_0128 |
− | ** | + | ** ArgRS |
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ARGINYLTRANSFERASE-RXN]] |
− | * | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[ | + | *** Assignment: ec-number |
− | * | + | == Pathways associated == |
− | * | + | |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1558309}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1565770}} | |
− | + | {{#set: centisome position=23.970352 }} | |
− | + | {{#set: common name=Esi_0073_0128|Esi0073_0128|ArgRS}} | |
− | + | {{#set: reaction associated=ARGINYLTRANSFERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:50, 21 March 2018
Gene Ec-10_001500
- left end position:
- 1558309
- transcription direction:
- NEGATIVE
- right end position:
- 1565770
- centisome position:
- 23.970352
- Synonym(s):
- Esi_0073_0128
- Esi0073_0128
- ArgRS
Reactions associated
- Reaction: ARGINYLTRANSFERASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome