Difference between revisions of "Ec-27 001600"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Gene == Gene Ec-27_001600 == * left end position: ** 1391747 * transcription direction: ** NEGATIVE * right end position: ** 1402966 * centisome position: ** 21.5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_001600 == |
− | * | + | * left end position: |
− | ** | + | ** 1391747 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1402966 |
− | * | + | * centisome position: |
− | ** | + | ** 21.577784 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0036_0002 |
− | ** | + | ** Esi0036_0002 |
− | ** | + | ** GRX |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-982]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * | + | * [[PWY-4621]] |
− | == | + | * [[PWY-4202]] |
− | * [[ | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=1391747}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1402966}} | |
− | + | {{#set: centisome position=21.577784 }} | |
− | + | {{#set: common name=Esi_0036_0002|Esi0036_0002|GRX}} | |
− | + | {{#set: reaction associated=RXN-982}} | |
− | + | {{#set: pathway associated=PWY-4621|PWY-4202}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:50, 21 March 2018
Gene Ec-27_001600
- left end position:
- 1391747
- transcription direction:
- NEGATIVE
- right end position:
- 1402966
- centisome position:
- 21.577784
- Synonym(s):
- Esi_0036_0002
- Esi0036_0002
- GRX
Reactions associated
- Reaction: RXN-982
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome