Difference between revisions of "L-ASPARTATE-OXID-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * inchi key: *...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Succi...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] ==
−
* smiles:
+
* direction:
−
** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J
+
 
* common name:
 
* common name:
−
** (R)-mevalonate diphosphate
+
** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
−
* molecular weight:
+
* ec number:
−
** 304.087   
+
** [http://enzyme.expasy.org/EC/1.4.3.16 EC-1.4.3.16]
 
* Synonym(s):
 
* Synonym(s):
−
** mevalonate-5-PP
 
−
** (R)-5-diphosphomevalonate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[L-ASPARTATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[IMINOASPARTATE]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
+
** 1 L-aspartate[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 2-iminosuccinate[c] '''+''' 1 hydrogen peroxide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-05_003640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5316]], nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5316 PWY-5316]
 +
** '''3''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7342]], superpathway of nicotine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7342 PWY-7342]
 +
** '''4''' reactions found over '''13''' reactions in the full pathway
 +
* [[PYRIDNUCSYN-PWY]], NAD biosynthesis I (from aspartate): [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY]
 +
** '''6''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 4872-34-8
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25876 25876]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916915 24916915]
+
* LIGAND-RXN:
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R00481 R00481]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57557 57557]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00357 R00357]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01143 C01143]
+
{{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}}
−
* HMDB : HMDB01090
+
{{#set: ec number=EC-1.4.3.16}}
−
{{#set: smiles=CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-]}}
+
{{#set: gene associated=Ec-05_003640}}
−
{{#set: inchi key=InChIKey=SIGQQUBJQXSAMW-ZCFIWIBFSA-J}}
+
{{#set: in pathway=PWY-5316|PWY-7342|PYRIDNUCSYN-PWY}}
−
{{#set: common name=(R)-mevalonate diphosphate}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=304.087    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: common name=mevalonate-5-PP|(R)-5-diphosphomevalonate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: consumed by=DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN}}
+
−
{{#set: consumed or produced by=PHOSPHOMEVALONATE-KINASE-RXN}}
+

Latest revision as of 19:50, 21 March 2018

Reaction L-ASPARTATE-OXID-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5316, nicotine biosynthesis: PWY-5316
    • 3 reactions found over 9 reactions in the full pathway
  • PWY-7342, superpathway of nicotine biosynthesis: PWY-7342
    • 4 reactions found over 13 reactions in the full pathway
  • PYRIDNUCSYN-PWY, NAD biosynthesis I (from aspartate): PYRIDNUCSYN-PWY
    • 6 reactions found over 6 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=L-ASPARTATE-OXID-RXN&oldid=29634"