Difference between revisions of "Ec-18 001440"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Ec-18_001440 == * Synonym(s): ** Esi_0269_0025 ** Esi0269_0025 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] ==
+
== Gene Ec-18_001440 ==
* smiles:
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
+
* inchi key:
+
** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
+
* common name:
+
** β-D-ribose 5-phosphate
+
* molecular weight:
+
** 228.095   
+
 
* Synonym(s):
 
* Synonym(s):
** β-D-ribofuranose 5-phosphate
+
** Esi_0269_0025
** 5-O-phosphono-β-D-ribofuranose
+
** Esi0269_0025
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-15346]]
+
* Reaction: [[RXN-8443]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-aragem]]
* [[RXN-15345]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0269_0025|Esi0269_0025}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377]
+
{{#set: reaction associated=RXN-8443}}
* CHEMSPIDER:
+
{{#set: pathway associated=PWY-5381}}
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722]
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}}
+
{{#set: common name=β-D-ribose 5-phosphate}}
+
{{#set: molecular weight=228.095    }}
+
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}}
+
{{#set: consumed by=RXN-15346}}
+
{{#set: produced by=RXN-15345}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-18_001440

  • Synonym(s):
    • Esi_0269_0025
    • Esi0269_0025

Reactions associated

Pathways associated

External links