Difference between revisions of "Ec-01 002250"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Gene == Gene Ec-01_002250 == * left end position: ** 1865477 * transcription direction: ** POSITIVE * right end position: ** 1867893 * centisome position: ** 18.0...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14901 CPD-14901] ==
+
== Gene Ec-01_002250 ==
−
* smiles:
+
* left end position:
−
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 1865477
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** poriferst-7-enol
+
** 1867893
−
* molecular weight:
+
* centisome position:
−
** 414.713    
+
** 18.078371    
 
* Synonym(s):
 
* Synonym(s):
−
** 22-dihydrochondrillasterol
+
** Esi_0003_0046
−
** 24β-ethylcholest-7-en-3β-ol
+
** Esi0003_0046
−
** chondrillast-7-enol
+
−
** dihydrochondrillasterol
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13892]]
+
* Reaction: [[2.7.8.23-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10827]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-10828]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-6322]]
 +
* [[PWY-7769]]
 
== External links  ==
 
== External links  ==
−
* CAS : 18525-35-4
+
{{#set: left end position=1865477}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12315364 12315364]
+
{{#set: right end position=1867893}}
−
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: centisome position=18.078371   }}
−
{{#set: inchi key=InChIKey=YSKVBPGQYRAUQO-XCFYOIDPSA-N}}
+
{{#set: common name=Esi_0003_0046|Esi0003_0046}}
−
{{#set: common name=poriferst-7-enol}}
+
{{#set: reaction associated=2.7.8.23-RXN|RXN-10827|RXN-10828}}
−
{{#set: molecular weight=414.713   }}
+
{{#set: pathway associated=PWY-6322|PWY-7769}}
−
{{#set: common name=22-dihydrochondrillasterol|24β-ethylcholest-7-en-3β-ol|chondrillast-7-enol|dihydrochondrillasterol}}
+
−
{{#set: consumed by=RXN-13892}}
+

Latest revision as of 19:50, 21 March 2018

Gene Ec-01_002250

  • left end position:
    • 1865477
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1867893
  • centisome position:
    • 18.078371
  • Synonym(s):
    • Esi_0003_0046
    • Esi0003_0046

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_002250&oldid=29677"