Difference between revisions of "GLC-1-P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == * direction: ** LEFT-TO-RIGHT * common name: ** Methylmalonate Semialdehyde...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=HXXFSFRBOHSIMQ-VFUOTHLCSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** α-D-glucopyranose 1-phosphate |
− | + | * molecular weight: | |
− | * | + | ** 258.121 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** glucose 1-phosphate | ||
+ | ** cori ester | ||
+ | ** D-glucose 1-phosphate | ||
+ | ** glucose-1P | ||
+ | ** α-glucose-1-phosphate | ||
+ | ** D-glucose-α-1-phosphate | ||
+ | ** α-D-glucose-1-P | ||
+ | ** D-glucose-1-phosphate | ||
+ | ** α-D-glucose 1-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-16997]] | |
− | + | * [[RXN-12486]] | |
− | + | * [[GALACTURIDYLYLTRANS-RXN]] | |
− | == | + | * [[GLUC1PURIDYLTRANS-RXN]] |
− | + | * [[PHOSPHOGLUCMUT-RXN]] | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | * | + | |
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 59-56-3 |
− | ** [http:// | + | * BIGG : 33865 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7091266 7091266] |
− | + | * HMDB : HMDB01586 | |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00103 C00103] | |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5441206.html 5441206] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58601 58601] |
− | {{#set: | + | * METABOLIGHTS : MTBLC58601 |
− | {{#set: | + | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
+ | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-VFUOTHLCSA-L}} | ||
+ | {{#set: common name=α-D-glucopyranose 1-phosphate}} | ||
+ | {{#set: molecular weight=258.121 }} | ||
+ | {{#set: common name=glucose 1-phosphate|cori ester|D-glucose 1-phosphate|glucose-1P|α-glucose-1-phosphate|D-glucose-α-1-phosphate|α-D-glucose-1-P|D-glucose-1-phosphate|α-D-glucose 1-phosphate}} | ||
+ | {{#set: reversible reaction associated=RXN-16997|RXN-12486|GALACTURIDYLYLTRANS-RXN|GLUC1PURIDYLTRANS-RXN|PHOSPHOGLUCMUT-RXN}} |
Latest revision as of 20:50, 21 March 2018
Contents
Metabolite GLC-1-P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-VFUOTHLCSA-L
- common name:
- α-D-glucopyranose 1-phosphate
- molecular weight:
- 258.121
- Synonym(s):
- glucose 1-phosphate
- cori ester
- D-glucose 1-phosphate
- glucose-1P
- α-glucose-1-phosphate
- D-glucose-α-1-phosphate
- α-D-glucose-1-P
- D-glucose-1-phosphate
- α-D-glucose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 59-56-3
- BIGG : 33865
- PUBCHEM:
- HMDB : HMDB01586
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58601
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.