Difference between revisions of "CPD-4201"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-26_001670 == * left end position: ** 2099502 * transcription direction: ** NEGATIVE * right end position: ** 2126688 * centisome position: ** 31.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K |
− | * | + | * common name: |
− | ** | + | ** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 572.278 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** iPTP |
− | ** | + | ** isopentenyladenosine riboside-5'-triphosphate |
+ | ** iPRTP | ||
+ | ** isopentenyladenosine-5'-triphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-4303]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424] |
+ | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}} | ||
+ | {{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}} | ||
+ | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}} | ||
+ | {{#set: molecular weight=572.278 }} | ||
+ | {{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}} | ||
+ | {{#set: produced by=RXN-4303}} |
Latest revision as of 20:50, 21 March 2018
Contents
Metabolite CPD-4201
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
- inchi key:
- InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
- molecular weight:
- 572.278
- Synonym(s):
- iPTP
- isopentenyladenosine riboside-5'-triphosphate
- iPRTP
- isopentenyladenosine-5'-triphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.