Difference between revisions of "Ec-07 005200"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-07_005200 == * left end position: ** 5059655 * transcription direction: ** NEGATIVE * right end position: ** 5066633 * centisome position: ** 65.5...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-07_005200 == |
− | * | + | * left end position: |
− | ** | + | ** 5059655 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5066633 |
− | * | + | * centisome position: |
− | ** | + | ** 65.51895 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0176_0048 |
− | ** | + | ** Esi0176_0048 |
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN66-482]] |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | * Reaction: [[TRANSENOYLCOARED-RXN]] |
− | == | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-389]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=5059655}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5066633}} | |
− | + | {{#set: centisome position=65.51895 }} | |
− | + | {{#set: common name=Esi_0176_0048|Esi0176_0048}} | |
− | + | {{#set: reaction associated=RXN66-482|TRANSENOYLCOARED-RXN}} | |
− | + | {{#set: pathway associated=PWY66-389}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:50, 21 March 2018
Gene Ec-07_005200
- left end position:
- 5059655
- transcription direction:
- NEGATIVE
- right end position:
- 5066633
- centisome position:
- 65.51895
- Synonym(s):
- Esi_0176_0048
- Esi0176_0048
Reactions associated
- Reaction: RXN66-482
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome
- Reaction: TRANSENOYLCOARED-RXN
- Source: annotation-esiliculosus_genome
- Assignment: ec-number
- Source: annotation-esiliculosus_genome