Difference between revisions of "RXN-9524"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9524 RXN-9524] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-octanoyl-[acyl-carrier...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9524 RXN-9524] ==
* smiles:
+
* direction:
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
+
 
* common name:
 
* common name:
** linustatin
+
** 3-oxo-octanoyl-[acyl-carrier protein] reductase
* molecular weight:
+
** NAD(P)-binding domain
** 409.389   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
** propanenitrile
 
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13602]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[3-Oxo-octanoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[3-Hydroxy-octanoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 a 3-oxo-octanoyl-[acp][c] '''+''' 1 NADPH[c] '''=>''' 1 a (3R)-3-hydroxyoctanoyl-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-01_007100]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''28''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''20''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
+
{{#set: common name=3-oxo-octanoyl-[acyl-carrier protein] reductase}}
* CHEBI:
+
{{#set: common name=NAD(P)-binding domain}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
+
{{#set: ec number=EC-2.3.1.86}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.85}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
+
{{#set: ec number=EC-1.1.1.100}}
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
{{#set: gene associated=Ec-01_007100}}
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
+
{{#set: in pathway=PWY-5971|PWY-5994}}
{{#set: common name=linustatin}}
+
{{#set: reconstruction category=annotation}}
{{#set: molecular weight=409.389    }}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: consumed by=RXN-13602}}
+

Latest revision as of 19:50, 21 March 2018

Reaction RXN-9524

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 28 reactions found over 31 reactions in the full pathway
  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 20 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"3-oxo-octanoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.