Difference between revisions of "RXN-15511"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15511 RXN-15511] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
* common name:
+
** 6-cis-tridecenoyl-CoA
+
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14771]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Protein-Histidines]][c] '''+''' 1 [[23-DIPHOSPHOGLYCERATE]][c] '''<=>''' 1 [[Protein-pi-phospho-L-histidines]][c] '''+''' 1 [[G3P]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a [protein]-L-histidine[c] '''+''' 1 2,3-diphospho-D-glycerate[c] '''<=>''' 1 a [protein]-N&pi;-phospho-L-histidine[c] '''+''' 1 3-phospho-D-glycerate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-6405]], Rapoport-Luebering glycolytic shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6405 PWY-6405]
 +
** '''1''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: in pathway=PWY-6405}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=957.819    }}
+
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14771}}
+

Latest revision as of 20:50, 21 March 2018

Reaction RXN-15511

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-6405, Rapoport-Luebering glycolytic shunt: PWY-6405
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links