Difference between revisions of "RXN-14997"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14997 RXN-14997] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14997 RXN-14997] ==
* smiles:
+
* direction:
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
+
* common name:
+
** 6-cis-tridecenoyl-CoA
+
* molecular weight:
+
** 957.819   
+
 
* Synonym(s):
 
* Synonym(s):
** 6Z-tridecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-14771]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-15318]][c] '''=>''' 1 [[CPD-15895]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 α-D-ribose 5-phosphate[c] '''=>''' 1 keto-D-ribose 5-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
+
{{#set: in pathway=}}
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction category=annotation}}
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: common name=6-cis-tridecenoyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: molecular weight=957.819    }}
+
{{#set: common name=6Z-tridecenoyl-CoA}}
+
{{#set: consumed by=RXN-14771}}
+

Latest revision as of 19:51, 21 March 2018

Reaction RXN-14997

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 α-D-ribose 5-phosphate[c] => 1 keto-D-ribose 5-phosphate[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links