Difference between revisions of "GLYCEROL-3P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Triacylglycerides Triacylglycerides] == * common name: ** a triglyceride * Synonym(s): == Reac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == |
| + | * smiles: | ||
| + | ** C(OP([O-])(=O)[O-])C(O)CO | ||
| + | * inchi key: | ||
| + | ** InChIKey=AWUCVROLDVIAJX-GSVOUGTGSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** sn-glycerol 3-phosphate |
| + | * molecular weight: | ||
| + | ** 170.058 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** L-α-glycerophosphate | ||
| + | ** L-G3P | ||
| + | ** L-glycerol 3-phosphate | ||
| + | ** α-glycerophosphoric acid | ||
| + | ** α-glycerophosphate | ||
| + | ** D-glycerol 1-phosphate | ||
| + | ** glycerol 3-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15045]] |
| + | * [[RXN0-5260]] | ||
| + | * [[RXN-17017]] | ||
| + | * [[RXN-17016]] | ||
| + | * [[RXN-17018]] | ||
| + | * [[RXN-15740]] | ||
| + | * [[RXN-15745]] | ||
| + | * [[RXN-10462]] | ||
| + | * [[RXN-16117]] | ||
| + | * [[RXN-16024]] | ||
| + | * [[RXN-1381]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14160]] | ||
| + | * [[GLYC3PDEHYDROGBIOSYN-RXN]] | ||
| + | * [[RXN-14073]] | ||
| + | * [[GLYCPDIESTER-RXN]] | ||
| + | * [[RXN0-5257]] | ||
| + | * [[RXN-14136]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PHOSPHAGLYPSYN-RXN]] | ||
| + | * [[RXN-13112]] | ||
| + | * [[1.1.1.8-RXN]] | ||
| + | * [[RXN-13805]] | ||
| + | * [[GLYCEROL-KIN-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 57-03-4 |
| − | {{#set: consumed by= | + | * BIGG : 137383 |
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7048686 7048686] | ||
| + | * HMDB : HMDB00126 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00093 C00093] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.2939444.html 2939444] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57597 57597] | ||
| + | * METABOLIGHTS : MTBLC57597 | ||
| + | {{#set: smiles=C(OP([O-])(=O)[O-])C(O)CO}} | ||
| + | {{#set: inchi key=InChIKey=AWUCVROLDVIAJX-GSVOUGTGSA-L}} | ||
| + | {{#set: common name=sn-glycerol 3-phosphate}} | ||
| + | {{#set: molecular weight=170.058 }} | ||
| + | {{#set: common name=L-α-glycerophosphate|L-G3P|L-glycerol 3-phosphate|α-glycerophosphoric acid|α-glycerophosphate|D-glycerol 1-phosphate|glycerol 3-phosphate}} | ||
| + | {{#set: consumed by=RXN-15045|RXN0-5260|RXN-17017|RXN-17016|RXN-17018|RXN-15740|RXN-15745|RXN-10462|RXN-16117|RXN-16024|RXN-1381}} | ||
| + | {{#set: produced by=RXN-14160|GLYC3PDEHYDROGBIOSYN-RXN|RXN-14073|GLYCPDIESTER-RXN|RXN0-5257|RXN-14136}} | ||
| + | {{#set: reversible reaction associated=PHOSPHAGLYPSYN-RXN|RXN-13112|1.1.1.8-RXN|RXN-13805|GLYCEROL-KIN-RXN}} | ||
Latest revision as of 19:51, 21 March 2018
Contents
Metabolite GLYCEROL-3P
- smiles:
- C(OP([O-])(=O)[O-])C(O)CO
- inchi key:
- InChIKey=AWUCVROLDVIAJX-GSVOUGTGSA-L
- common name:
- sn-glycerol 3-phosphate
- molecular weight:
- 170.058
- Synonym(s):
- L-α-glycerophosphate
- L-G3P
- L-glycerol 3-phosphate
- α-glycerophosphoric acid
- α-glycerophosphate
- D-glycerol 1-phosphate
- glycerol 3-phosphate
Reaction(s) known to consume the compound
- RXN-15045
- RXN0-5260
- RXN-17017
- RXN-17016
- RXN-17018
- RXN-15740
- RXN-15745
- RXN-10462
- RXN-16117
- RXN-16024
- RXN-1381
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 57-03-4
- BIGG : 137383
- PUBCHEM:
- HMDB : HMDB00126
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57597
"C(OP([O-])(=O)[O-])C(O)CO" cannot be used as a page name in this wiki.
