Difference between revisions of "RXN-8450"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] == * smiles: ** CC(C(=O)SCCNC(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-3-HYDROXY-BUTYRYL-COA 2-METHYL-3-HYDROXY-BUTYRYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8450 RXN-8450] ==
−
* smiles:
+
* direction:
−
** CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J
+
** [http://enzyme.expasy.org/EC/1.14.11.23 EC-1.14.11.23]
−
* common name:
+
−
** (2S,3S)-3-hydroxy-2-methylbutanoyl-CoA
+
−
* molecular weight:
+
−
** 863.619   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-methyl-3-hydroxybutyryl-CoA
 
−
** (2S,3S)-3-hydroxy-2-methylbutyryl-CoA
 
−
** (S)-3-hydroxy-2-methylbutyryl-CoA
 
−
** 3-hydroxy-2-methylbutyryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-7087]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[MYRICETIN]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c]
−
* [[TIGLYLCOA-HYDROXY-RXN]]
+
* With common name(s):
−
* [[1.1.1.178-RXN]]
+
** 1 2-oxoglutarate[c] '''+''' 1 (+)-dihydromyricetin[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 myricetin[c] '''+''' 1 CO2[c] '''+''' 1 succinate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-3101]], flavonol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3101 PWY-3101]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-5391]], syringetin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5391 PWY-5391]
 +
** '''1''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657672 90657672]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06539 R06539]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15449 15449]
+
{{#set: ec number=EC-1.14.11.23}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-19_002760|Ec-08_003510|Ec-19_002750}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04405 C04405]
+
{{#set: in pathway=PWY-3101|PWY-5391}}
−
* HMDB : HMDB01356
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C(C)O}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: inchi key=InChIKey=PEKYNTFSOBAABV-LQUDNSJZSA-J}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=(2S,3S)-3-hydroxy-2-methylbutanoyl-CoA}}
+
−
{{#set: molecular weight=863.619    }}
+
−
{{#set: common name=2-methyl-3-hydroxybutyryl-CoA|(2S,3S)-3-hydroxy-2-methylbutyryl-CoA|(S)-3-hydroxy-2-methylbutyryl-CoA|3-hydroxy-2-methylbutyryl-CoA}}
+
−
{{#set: reversible reaction associated=TIGLYLCOA-HYDROXY-RXN|1.1.1.178-RXN}}
+

Latest revision as of 20:51, 21 March 2018

Reaction RXN-8450

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-3101, flavonol biosynthesis: PWY-3101
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-5391, syringetin biosynthesis: PWY-5391
    • 1 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8450&oldid=29770"