Difference between revisions of "CPD-19155"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_005740 == * left end position: ** 4983791 * transcription direction: ** NEGATIVE * right end position: ** 4994540 * centisome position: ** 48.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J |
| − | * | + | * common name: |
| − | ** | + | ** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA |
| − | * | + | * molecular weight: |
| − | ** | + | ** 1015.898 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (S)-3-hydroxy-16:1-Δ9-CoA |
| − | ** | + | ** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-17790]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-17789]] |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}} |
| − | {{#set: | + | {{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: molecular weight=1015.898 }} |
| − | {{#set: common name= | + | {{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}} |
| − | {{#set: | + | {{#set: consumed by=RXN-17790}} |
| + | {{#set: produced by=RXN-17789}} | ||
Latest revision as of 20:51, 21 March 2018
Contents
Metabolite CPD-19155
- smiles:
- CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
- common name:
- (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
- molecular weight:
- 1015.898
- Synonym(s):
- (S)-3-hydroxy-16:1-Δ9-CoA
- (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
