Difference between revisions of "Ec-23 003500"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] == * smiles: ** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
 
(Created page with "Category:Gene == Gene Ec-23_003500 == * left end position: ** 3764556 * transcription direction: ** NEGATIVE * right end position: ** 3775157 * centisome position: ** 77.7...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19155 CPD-19155] ==
+
== Gene Ec-23_003500 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3764556
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** (S)-3-hydroxy-(9Z)-hexadecenoyl-CoA
+
** 3775157
−
* molecular weight:
+
* centisome position:
−
** 1015.898    
+
** 77.78865    
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-16:1-Δ9-CoA
+
** Esi_0128_0018
−
** (S)-3-hydroxy-9-cis-hexadecenoyl-CoA
+
** Esi0128_0018
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17790]]
+
* Reaction: [[ASPAMINOTRANS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-17789]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[PHEAMINOTRANS-RXN]]
 +
** Source: [[orthology-aragem]]
 +
* Reaction: [[RXN-10814]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-11737]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13697]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-5913]]
 +
* [[PHESYN]]
 +
* [[PWY-6318]]
 +
* [[PWY-7383]]
 +
* [[ASPARTATE-DEG1-PWY]]
 +
* [[PWY-6643]]
 +
* [[PWY-6642]]
 +
* [[PWY-6638]]
 +
* [[ASPARTATESYN-PWY]]
 +
* [[PWY-7432]]
 +
* [[PWY-7117]]
 +
* [[GLUTDEG-PWY]]
 +
* [[PWY-7115]]
 +
* [[PWY-5079]]
 +
* [[MALATE-ASPARTATE-SHUTTLE-PWY]]
 +
* [[ANAPHENOXI-PWY]]
 +
* [[ASPARAGINE-DEG1-PWY-1]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=3764556}}
−
{{#set: inchi key=InChIKey=ZIRSQPAPHGZDIL-VSCXGISKSA-J}}
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: common name=(S)-3-hydroxy-(9Z)-hexadecenoyl-CoA}}
+
{{#set: right end position=3775157}}
−
{{#set: molecular weight=1015.898   }}
+
{{#set: centisome position=77.78865   }}
−
{{#set: common name=(S)-3-hydroxy-16:1-Δ9-CoA|(S)-3-hydroxy-9-cis-hexadecenoyl-CoA}}
+
{{#set: common name=Esi_0128_0018|Esi0128_0018}}
−
{{#set: consumed by=RXN-17790}}
+
{{#set: reaction associated=ASPAMINOTRANS-RXN|PHEAMINOTRANS-RXN|RXN-10814|RXN-11737|RXN-13697}}
−
{{#set: produced by=RXN-17789}}
+
{{#set: pathway associated=PWY-5913|PHESYN|PWY-6318|PWY-7383|ASPARTATE-DEG1-PWY|PWY-6643|PWY-6642|PWY-6638|ASPARTATESYN-PWY|PWY-7432|PWY-7117|GLUTDEG-PWY|PWY-7115|PWY-5079|MALATE-ASPARTATE-SHUTTLE-PWY|ANAPHENOXI-PWY|ASPARAGINE-DEG1-PWY-1}}

Latest revision as of 19:51, 21 March 2018

Gene Ec-23_003500

  • left end position:
    • 3764556
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 3775157
  • centisome position:
    • 77.78865
  • Synonym(s):
    • Esi_0128_0018
    • Esi0128_0018

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-23_003500&oldid=29790"